C14H12Cl2N2O2 — CID 46651015
N-[2-(2,4-dichlorophenyl)ethyl]-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 46651015) has the molecular formula C14H12Cl2N2O2 and a molecular weight of 311.17 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46651015 |
| Molecular Formula | C14H12Cl2N2O2 |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1Cl)c1ccc[nH]c1=O |
| InChI | InChI=1S/C14H12Cl2N2O2/c15-10-4-3-9(12(16)8-10)5-7-18-14(20)11-2-1-6-17-13(11)19/h1-4,6,8H,5,7H2,(H,17,19)(H,18,20) |
| InChIKey | YBPVDCHYIQSEAE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |