C14H14Cl2N4O — CID 62235630
N-[2-(2,4-dichlorophenyl)ethyl]-2-hydrazinylpyridine-3-carboxamide (PubChem CID 62235630) has the molecular formula C14H14Cl2N4O and a molecular weight of 325.20 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-2-hydrazinylpyridine-3-carboxamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-hydrazinylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 62235630 |
| Molecular Formula | C14H14Cl2N4O |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-hydrazinylpyridine-3-carboxamide |
| SMILES | NNc1ncccc1C(=O)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H14Cl2N4O/c15-10-4-3-9(12(16)8-10)5-7-19-14(21)11-2-1-6-18-13(11)20-17/h1-4,6,8H,5,7,17H2,(H,18,20)(H,19,21) |
| InChIKey | RCRUNQDGDPLTEY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|