C15H12BrCl2NO — CID 2547735
2-bromo-N-[2-(2,4-dichlorophenyl)ethyl]benzamide (PubChem CID 2547735) has the molecular formula C15H12BrCl2NO and a molecular weight of 373.08 g/mol. Its IUPAC name is 2-bromo-N-[2-(2,4-dichlorophenyl)ethyl]benzamide.
| Compound Name | 2-bromo-N-[2-(2,4-dichlorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 2547735 |
| Molecular Formula | C15H12BrCl2NO |
| Molecular Weight | 373.08 g/mol |
| Exact Mass | 370.95 |
| IUPAC Name | 2-bromo-N-[2-(2,4-dichlorophenyl)ethyl]benzamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1Cl)c1ccccc1Br |
| InChI | InChI=1S/C15H12BrCl2NO/c16-13-4-2-1-3-12(13)15(20)19-8-7-10-5-6-11(17)9-14(10)18/h1-6,9H,7-8H2,(H,19,20) |
| InChIKey | NJTCZGSKSCOIRK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.08 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |