C15H12BrCl2NOS — CID 107021702
4-bromo-N-[2-(2,4-dichlorophenyl)ethyl]-2-sulfanylbenzamide (PubChem CID 107021702) has the molecular formula C15H12BrCl2NOS and a molecular weight of 405.14 g/mol. Its IUPAC name is 4-bromo-N-[2-(2,4-dichlorophenyl)ethyl]-2-sulfanylbenzamide.
| Compound Name | 4-bromo-N-[2-(2,4-dichlorophenyl)ethyl]-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 107021702 |
| Molecular Formula | C15H12BrCl2NOS |
| Molecular Weight | 405.14 g/mol |
| Exact Mass | 402.92 |
| IUPAC Name | 4-bromo-N-[2-(2,4-dichlorophenyl)ethyl]-2-sulfanylbenzamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1Cl)c1ccc(Br)cc1S |
| InChI | InChI=1S/C15H12BrCl2NOS/c16-10-2-4-12(14(21)7-10)15(20)19-6-5-9-1-3-11(17)8-13(9)18/h1-4,7-8,21H,5-6H2,(H,19,20) |
| InChIKey | JMXOTQGNJZIMIE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.14 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|