C16H14BrCl2NO — CID 104851790
3-bromo-N-[2-(2,4-dichlorophenyl)ethyl]-5-methylbenzamide (PubChem CID 104851790) has the molecular formula C16H14BrCl2NO and a molecular weight of 387.10 g/mol. Its IUPAC name is 3-bromo-N-[2-(2,4-dichlorophenyl)ethyl]-5-methylbenzamide.
| Compound Name | 3-bromo-N-[2-(2,4-dichlorophenyl)ethyl]-5-methylbenzamide |
|---|---|
| PubChem CID | 104851790 |
| Molecular Formula | C16H14BrCl2NO |
| Molecular Weight | 387.10 g/mol |
| Exact Mass | 384.96 |
| IUPAC Name | 3-bromo-N-[2-(2,4-dichlorophenyl)ethyl]-5-methylbenzamide |
| SMILES | Cc1cc(Br)cc(C(=O)NCCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C16H14BrCl2NO/c1-10-6-12(8-13(17)7-10)16(21)20-5-4-11-2-3-14(18)9-15(11)19/h2-3,6-9H,4-5H2,1H3,(H,20,21) |
| InChIKey | UBAWJVCAESKZLZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.10 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |