C12H12Cl2N4O — CID 64525006
3-amino-N-[2-(2,4-dichlorophenyl)ethyl]-1H-pyrazole-5-carboxamide (PubChem CID 64525006) has the molecular formula C12H12Cl2N4O and a molecular weight of 299.16 g/mol. Its IUPAC name is 3-amino-N-[2-(2,4-dichlorophenyl)ethyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-amino-N-[2-(2,4-dichlorophenyl)ethyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 64525006 |
| Molecular Formula | C12H12Cl2N4O |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 3-amino-N-[2-(2,4-dichlorophenyl)ethyl]-1H-pyrazole-5-carboxamide |
| SMILES | Nc1cc(C(=O)NCCc2ccc(Cl)cc2Cl)[nH]n1 |
| InChI | InChI=1S/C12H12Cl2N4O/c13-8-2-1-7(9(14)5-8)3-4-16-12(19)10-6-11(15)18-17-10/h1-2,5-6H,3-4H2,(H,16,19)(H3,15,17,18) |
| InChIKey | ILHYYMCYGHPGIV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |