C17H13Cl2FN2O — CID 113206229
N-[2-(2,4-dichlorophenyl)ethyl]-6-fluoro-1H-indole-3-carboxamide (PubChem CID 113206229) has the molecular formula C17H13Cl2FN2O and a molecular weight of 351.21 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-6-fluoro-1H-indole-3-carboxamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-6-fluoro-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 113206229 |
| Molecular Formula | C17H13Cl2FN2O |
| Molecular Weight | 351.21 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-6-fluoro-1H-indole-3-carboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1Cl)c1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C17H13Cl2FN2O/c18-11-2-1-10(15(19)7-11)5-6-21-17(23)14-9-22-16-8-12(20)3-4-13(14)16/h1-4,7-9,22H,5-6H2,(H,21,23) |
| InChIKey | XSWMFRPHYLQJOV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.21 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |