C17H13ClF2N2O — CID 113083843
N-[2-(6-chloro-1H-indol-3-yl)ethyl]-3,4-difluorobenzamide (PubChem CID 113083843) has the molecular formula C17H13ClF2N2O and a molecular weight of 334.75 g/mol. Its IUPAC name is N-[2-(6-chloro-1H-indol-3-yl)ethyl]-3,4-difluorobenzamide.
| Compound Name | N-[2-(6-chloro-1H-indol-3-yl)ethyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 113083843 |
| Molecular Formula | C17H13ClF2N2O |
| Molecular Weight | 334.75 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | N-[2-(6-chloro-1H-indol-3-yl)ethyl]-3,4-difluorobenzamide |
| SMILES | O=C(NCCc1c[nH]c2cc(Cl)ccc12)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H13ClF2N2O/c18-12-2-3-13-11(9-22-16(13)8-12)5-6-21-17(23)10-1-4-14(19)15(20)7-10/h1-4,7-9,22H,5-6H2,(H,21,23) |
| InChIKey | WRQZYCDRYARWEW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.75 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |