C24H19ClF2N2O — CID 67974093
N-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-fluoro-4-[(3-fluorophenyl)methyl]benzamide (PubChem CID 67974093) has the molecular formula C24H19ClF2N2O and a molecular weight of 424.88 g/mol. Its IUPAC name is N-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-fluoro-4-[(3-fluorophenyl)methyl]benzamide.
| Compound Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-fluoro-4-[(3-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 67974093 |
| Molecular Formula | C24H19ClF2N2O |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-fluoro-4-[(3-fluorophenyl)methyl]benzamide |
| SMILES | O=C(NCCc1c[nH]c2ccc(Cl)cc12)c1ccc(Cc2cccc(F)c2)c(F)c1 |
| InChI | InChI=1S/C24H19ClF2N2O/c25-19-6-7-23-21(13-19)18(14-29-23)8-9-28-24(30)17-5-4-16(22(27)12-17)10-15-2-1-3-20(26)11-15/h1-7,11-14,29H,8-10H2,(H,28,30) |
| InChIKey | YIMNHRRYAINJTD-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |