C25H20ClN3O — CID 67974504
N-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-[(2-cyanophenyl)methyl]benzamide (PubChem CID 67974504) has the molecular formula C25H20ClN3O and a molecular weight of 413.91 g/mol. Its IUPAC name is N-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-[(2-cyanophenyl)methyl]benzamide.
| Compound Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-[(2-cyanophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 67974504 |
| Molecular Formula | C25H20ClN3O |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-[(2-cyanophenyl)methyl]benzamide |
| SMILES | N#Cc1ccccc1Cc1cccc(C(=O)NCCc2c[nH]c3ccc(Cl)cc23)c1 |
| InChI | InChI=1S/C25H20ClN3O/c26-22-8-9-24-23(14-22)21(16-29-24)10-11-28-25(30)19-7-3-4-17(13-19)12-18-5-1-2-6-20(18)15-27/h1-9,13-14,16,29H,10-12H2,(H,28,30) |
| InChIKey | HBNBPWFISBACEY-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |