C13H14ClN3O2 — CID 112731782
4-chloro-2-hydroxy-N-[2-(1-methylpyrazol-4-yl)ethyl]benzamide (PubChem CID 112731782) has the molecular formula C13H14ClN3O2 and a molecular weight of 279.73 g/mol. Its IUPAC name is 4-chloro-2-hydroxy-N-[2-(1-methylpyrazol-4-yl)ethyl]benzamide.
| Compound Name | 4-chloro-2-hydroxy-N-[2-(1-methylpyrazol-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 112731782 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 4-chloro-2-hydroxy-N-[2-(1-methylpyrazol-4-yl)ethyl]benzamide |
| SMILES | Cn1cc(CCNC(=O)c2ccc(Cl)cc2O)cn1 |
| InChI | InChI=1S/C13H14ClN3O2/c1-17-8-9(7-16-17)4-5-15-13(19)11-3-2-10(14)6-12(11)18/h2-3,6-8,18H,4-5H2,1H3,(H,15,19) |
| InChIKey | MBIRGAPYLINKBS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |