C15H18ClN3O2 — CID 167818894
5-chloro-4-hydroxy-2-methyl-N-[3-(1-methylpyrazol-4-yl)propyl]benzamide (PubChem CID 167818894) has the molecular formula C15H18ClN3O2 and a molecular weight of 307.78 g/mol. Its IUPAC name is 5-chloro-4-hydroxy-2-methyl-N-[3-(1-methylpyrazol-4-yl)propyl]benzamide.
| Compound Name | 5-chloro-4-hydroxy-2-methyl-N-[3-(1-methylpyrazol-4-yl)propyl]benzamide |
|---|---|
| PubChem CID | 167818894 |
| Molecular Formula | C15H18ClN3O2 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 5-chloro-4-hydroxy-2-methyl-N-[3-(1-methylpyrazol-4-yl)propyl]benzamide |
| SMILES | Cc1cc(O)c(Cl)cc1C(=O)NCCCc1cnn(C)c1 |
| InChI | InChI=1S/C15H18ClN3O2/c1-10-6-14(20)13(16)7-12(10)15(21)17-5-3-4-11-8-18-19(2)9-11/h6-9,20H,3-5H2,1-2H3,(H,17,21) |
| InChIKey | MJKJEKJKVOKOMG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|