C24H25ClN2O2 — CID 4279408
1-(4-chlorophenyl)-N-[2-(7-methyl-2-oxo-1H-quinolin-3-yl)ethyl]cyclopentane-1-carboxamide (PubChem CID 4279408) has the molecular formula C24H25ClN2O2 and a molecular weight of 408.93 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[2-(7-methyl-2-oxo-1H-quinolin-3-yl)ethyl]cyclopentane-1-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[2-(7-methyl-2-oxo-1H-quinolin-3-yl)ethyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 4279408 |
| Molecular Formula | C24H25ClN2O2 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[2-(7-methyl-2-oxo-1H-quinolin-3-yl)ethyl]cyclopentane-1-carboxamide |
| SMILES | Cc1ccc2cc(CCNC(=O)C3(c4ccc(Cl)cc4)CCCC3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C24H25ClN2O2/c1-16-4-5-17-15-18(22(28)27-21(17)14-16)10-13-26-23(29)24(11-2-3-12-24)19-6-8-20(25)9-7-19/h4-9,14-15H,2-3,10-13H2,1H3,(H,26,29)(H,27,28) |
| InChIKey | CRDXUNKEHJCTFA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |