C20H19FN2O4 — CID 110326115
N-[2-(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-2-fluorobenzamide (PubChem CID 110326115) has the molecular formula C20H19FN2O4 and a molecular weight of 370.38 g/mol. Its IUPAC name is N-[2-(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-2-fluorobenzamide.
| Compound Name | N-[2-(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 110326115 |
| Molecular Formula | C20H19FN2O4 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N-[2-(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]-2-fluorobenzamide |
| SMILES | COc1cc2cc(CCNC(=O)c3ccccc3F)c(=O)[nH]c2cc1OC |
| InChI | InChI=1S/C20H19FN2O4/c1-26-17-10-13-9-12(19(24)23-16(13)11-18(17)27-2)7-8-22-20(25)14-5-3-4-6-15(14)21/h3-6,9-11H,7-8H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | CYNZMUIIHBTDED-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |