C19H16ClFN2O3 — CID 110415543
N-[2-(7-chloro-6-methoxy-2-oxo-1H-quinolin-3-yl)ethyl]-4-fluorobenzamide (PubChem CID 110415543) has the molecular formula C19H16ClFN2O3 and a molecular weight of 374.80 g/mol. Its IUPAC name is N-[2-(7-chloro-6-methoxy-2-oxo-1H-quinolin-3-yl)ethyl]-4-fluorobenzamide.
| Compound Name | N-[2-(7-chloro-6-methoxy-2-oxo-1H-quinolin-3-yl)ethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 110415543 |
| Molecular Formula | C19H16ClFN2O3 |
| Molecular Weight | 374.80 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | N-[2-(7-chloro-6-methoxy-2-oxo-1H-quinolin-3-yl)ethyl]-4-fluorobenzamide |
| SMILES | COc1cc2cc(CCNC(=O)c3ccc(F)cc3)c(=O)[nH]c2cc1Cl |
| InChI | InChI=1S/C19H16ClFN2O3/c1-26-17-9-13-8-12(19(25)23-16(13)10-15(17)20)6-7-22-18(24)11-2-4-14(21)5-3-11/h2-5,8-10H,6-7H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | IXOCSCUUSLJTFF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.80 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |