C17H22ClN3O3 — CID 110662896
1-tert-butyl-3-[2-(7-chloro-6-methoxy-2-oxo-1H-quinolin-3-yl)ethyl]urea (PubChem CID 110662896) has the molecular formula C17H22ClN3O3 and a molecular weight of 351.83 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-(7-chloro-6-methoxy-2-oxo-1H-quinolin-3-yl)ethyl]urea.
| Compound Name | 1-tert-butyl-3-[2-(7-chloro-6-methoxy-2-oxo-1H-quinolin-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 110662896 |
| Molecular Formula | C17H22ClN3O3 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 1-tert-butyl-3-[2-(7-chloro-6-methoxy-2-oxo-1H-quinolin-3-yl)ethyl]urea |
| SMILES | COc1cc2cc(CCNC(=O)NC(C)(C)C)c(=O)[nH]c2cc1Cl |
| InChI | InChI=1S/C17H22ClN3O3/c1-17(2,3)21-16(23)19-6-5-10-7-11-8-14(24-4)12(18)9-13(11)20-15(10)22/h7-9H,5-6H2,1-4H3,(H,20,22)(H2,19,21,23) |
| InChIKey | LJDMAAFNWVIQAD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |