C18H22ClN3O4 — CID 110609264
1-[2-(7-chloro-6-methoxy-2-oxo-1H-quinolin-3-yl)ethyl]-3-(oxan-4-yl)urea (PubChem CID 110609264) has the molecular formula C18H22ClN3O4 and a molecular weight of 379.84 g/mol. Its IUPAC name is 1-[2-(7-chloro-6-methoxy-2-oxo-1H-quinolin-3-yl)ethyl]-3-(oxan-4-yl)urea.
| Compound Name | 1-[2-(7-chloro-6-methoxy-2-oxo-1H-quinolin-3-yl)ethyl]-3-(oxan-4-yl)urea |
|---|---|
| PubChem CID | 110609264 |
| Molecular Formula | C18H22ClN3O4 |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 1-[2-(7-chloro-6-methoxy-2-oxo-1H-quinolin-3-yl)ethyl]-3-(oxan-4-yl)urea |
| SMILES | COc1cc2cc(CCNC(=O)NC3CCOCC3)c(=O)[nH]c2cc1Cl |
| InChI | InChI=1S/C18H22ClN3O4/c1-25-16-9-12-8-11(17(23)22-15(12)10-14(16)19)2-5-20-18(24)21-13-3-6-26-7-4-13/h8-10,13H,2-7H2,1H3,(H,22,23)(H2,20,21,24) |
| InChIKey | OCKBGZSUZDBIAS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |