C19H25N3O3 — CID 110609150
1-[2-(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]-3-(oxan-4-yl)urea (PubChem CID 110609150) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 1-[2-(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]-3-(oxan-4-yl)urea.
| Compound Name | 1-[2-(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]-3-(oxan-4-yl)urea |
|---|---|
| PubChem CID | 110609150 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 1-[2-(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]-3-(oxan-4-yl)urea |
| SMILES | Cc1cc(C)c2cc(CCNC(=O)NC3CCOCC3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C19H25N3O3/c1-12-9-13(2)16-11-14(18(23)22-17(16)10-12)3-6-20-19(24)21-15-4-7-25-8-5-15/h9-11,15H,3-8H2,1-2H3,(H,22,23)(H2,20,21,24) |
| InChIKey | HXKMTIYXAQBRNV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |