C19H26N2O4 — CID 110298971
3-(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)-N-(3-methylbutyl)propanamide (PubChem CID 110298971) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 3-(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)-N-(3-methylbutyl)propanamide.
| Compound Name | 3-(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)-N-(3-methylbutyl)propanamide |
|---|---|
| PubChem CID | 110298971 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 3-(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)-N-(3-methylbutyl)propanamide |
| SMILES | COc1cc2cc(CCC(=O)NCCC(C)C)c(=O)[nH]c2cc1OC |
| InChI | InChI=1S/C19H26N2O4/c1-12(2)7-8-20-18(22)6-5-13-9-14-10-16(24-3)17(25-4)11-15(14)21-19(13)23/h9-12H,5-8H2,1-4H3,(H,20,22)(H,21,23) |
| InChIKey | YCUIDPRXBBUZJZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |