C20H19ClN2O4 — CID 110326133
4-chloro-N-[2-(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]benzamide (PubChem CID 110326133) has the molecular formula C20H19ClN2O4 and a molecular weight of 386.84 g/mol. Its IUPAC name is 4-chloro-N-[2-(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]benzamide.
| Compound Name | 4-chloro-N-[2-(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 110326133 |
| Molecular Formula | C20H19ClN2O4 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 4-chloro-N-[2-(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)ethyl]benzamide |
| SMILES | COc1cc2cc(CCNC(=O)c3ccc(Cl)cc3)c(=O)[nH]c2cc1OC |
| InChI | InChI=1S/C20H19ClN2O4/c1-26-17-10-14-9-13(20(25)23-16(14)11-18(17)27-2)7-8-22-19(24)12-3-5-15(21)6-4-12/h3-6,9-11H,7-8H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | LCEFDUOASSZYRS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |