C22H24N2O4 — CID 4182872
N-[2-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]-3,4-dimethoxybenzamide (PubChem CID 4182872) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is N-[2-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 4182872 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-[2-(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCc2cc3cc(C)c(C)cc3[nH]c2=O)cc1OC |
| InChI | InChI=1S/C22H24N2O4/c1-13-9-17-11-16(22(26)24-18(17)10-14(13)2)7-8-23-21(25)15-5-6-19(27-3)20(12-15)28-4/h5-6,9-12H,7-8H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | PLIZQVWYOBTGSO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |