C21H22F2N2O5 — CID 90485315
N-[(2,4-difluorophenyl)methyl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine;oxalic acid (PubChem CID 90485315) has the molecular formula C21H22F2N2O5 and a molecular weight of 420.41 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine;oxalic acid.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine;oxalic acid |
|---|---|
| PubChem CID | 90485315 |
| Molecular Formula | C21H22F2N2O5 |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanamine;oxalic acid |
| SMILES | COc1ccc2[nH]c(C)c(CCNCc3ccc(F)cc3F)c2c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H20F2N2O.C2H2O4/c1-12-16(17-10-15(24-2)5-6-19(17)23-12)7-8-22-11-13-3-4-14(20)9-18(13)21;3-1(4)2(5)6/h3-6,9-10,22-23H,7-8,11H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | VEGHXTYLHNJNDX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|