C19H21ClN2O — CID 45497559
2-(5-chloro-2-methyl-1H-indol-3-yl)-N-[(2-methoxyphenyl)methyl]ethanamine (PubChem CID 45497559) has the molecular formula C19H21ClN2O and a molecular weight of 328.84 g/mol. Its IUPAC name is 2-(5-chloro-2-methyl-1H-indol-3-yl)-N-[(2-methoxyphenyl)methyl]ethanamine.
| Compound Name | 2-(5-chloro-2-methyl-1H-indol-3-yl)-N-[(2-methoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 45497559 |
| Molecular Formula | C19H21ClN2O |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 2-(5-chloro-2-methyl-1H-indol-3-yl)-N-[(2-methoxyphenyl)methyl]ethanamine |
| SMILES | COc1ccccc1CNCCc1c(C)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C19H21ClN2O/c1-13-16(17-11-15(20)7-8-18(17)22-13)9-10-21-12-14-5-3-4-6-19(14)23-2/h3-8,11,21-22H,9-10,12H2,1-2H3 |
| InChIKey | ZQQIFYIAWXOMNG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|