C13H17ClN2 — CID 82496893
2-(5-chloro-2-methyl-1H-indol-3-yl)-N-ethylethanamine (PubChem CID 82496893) has the molecular formula C13H17ClN2 and a molecular weight of 236.75 g/mol. Its IUPAC name is 2-(5-chloro-2-methyl-1H-indol-3-yl)-N-ethylethanamine.
| Compound Name | 2-(5-chloro-2-methyl-1H-indol-3-yl)-N-ethylethanamine |
|---|---|
| PubChem CID | 82496893 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 2-(5-chloro-2-methyl-1H-indol-3-yl)-N-ethylethanamine |
| SMILES | CCNCCc1c(C)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C13H17ClN2/c1-3-15-7-6-11-9(2)16-13-5-4-10(14)8-12(11)13/h4-5,8,15-16H,3,6-7H2,1-2H3 |
| InChIKey | CHTFVJCZHWGJMZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|