C12H15ClN2O2S — CID 113086047
N-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]methanesulfonamide (PubChem CID 113086047) has the molecular formula C12H15ClN2O2S and a molecular weight of 286.78 g/mol. Its IUPAC name is N-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]methanesulfonamide.
| Compound Name | N-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 113086047 |
| Molecular Formula | C12H15ClN2O2S |
| Molecular Weight | 286.78 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | N-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]methanesulfonamide |
| SMILES | Cc1[nH]c2ccc(Cl)cc2c1CCNS(C)(=O)=O |
| InChI | InChI=1S/C12H15ClN2O2S/c1-8-10(5-6-14-18(2,16)17)11-7-9(13)3-4-12(11)15-8/h3-4,7,14-15H,5-6H2,1-2H3 |
| InChIKey | VSYHEGDMTUBJKB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.78 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|