C12H13Cl2N3O3S — CID 166187794
3,5-dichloro-N-[2-(methanesulfonamido)ethyl]-1H-indole-2-carboxamide (PubChem CID 166187794) has the molecular formula C12H13Cl2N3O3S and a molecular weight of 350.23 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-(methanesulfonamido)ethyl]-1H-indole-2-carboxamide.
| Compound Name | 3,5-dichloro-N-[2-(methanesulfonamido)ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 166187794 |
| Molecular Formula | C12H13Cl2N3O3S |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 3,5-dichloro-N-[2-(methanesulfonamido)ethyl]-1H-indole-2-carboxamide |
| SMILES | CS(=O)(=O)NCCNC(=O)c1[nH]c2ccc(Cl)cc2c1Cl |
| InChI | InChI=1S/C12H13Cl2N3O3S/c1-21(19,20)16-5-4-15-12(18)11-10(14)8-6-7(13)2-3-9(8)17-11/h2-3,6,16-17H,4-5H2,1H3,(H,15,18) |
| InChIKey | XIKDFLACFMKEBB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|