C16H20Cl2N2O2 — CID 111520117
3,5-dichloro-N-(4-hydroxy-2,2-dimethylpentyl)-1H-indole-2-carboxamide (PubChem CID 111520117) has the molecular formula C16H20Cl2N2O2 and a molecular weight of 343.25 g/mol. Its IUPAC name is 3,5-dichloro-N-(4-hydroxy-2,2-dimethylpentyl)-1H-indole-2-carboxamide.
| Compound Name | 3,5-dichloro-N-(4-hydroxy-2,2-dimethylpentyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 111520117 |
| Molecular Formula | C16H20Cl2N2O2 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 3,5-dichloro-N-(4-hydroxy-2,2-dimethylpentyl)-1H-indole-2-carboxamide |
| SMILES | CC(O)CC(C)(C)CNC(=O)c1[nH]c2ccc(Cl)cc2c1Cl |
| InChI | InChI=1S/C16H20Cl2N2O2/c1-9(21)7-16(2,3)8-19-15(22)14-13(18)11-6-10(17)4-5-12(11)20-14/h4-6,9,20-21H,7-8H2,1-3H3,(H,19,22) |
| InChIKey | FSFUCQRWJHNTBK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |