C14H14Cl2N2O3 — CID 119191758
3-[(3,5-dichloro-1H-indole-2-carbonyl)-ethylamino]propanoic acid (PubChem CID 119191758) has the molecular formula C14H14Cl2N2O3 and a molecular weight of 329.18 g/mol. Its IUPAC name is 3-[(3,5-dichloro-1H-indole-2-carbonyl)-ethylamino]propanoic acid.
| Compound Name | 3-[(3,5-dichloro-1H-indole-2-carbonyl)-ethylamino]propanoic acid |
|---|---|
| PubChem CID | 119191758 |
| Molecular Formula | C14H14Cl2N2O3 |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 3-[(3,5-dichloro-1H-indole-2-carbonyl)-ethylamino]propanoic acid |
| SMILES | CCN(CCC(=O)O)C(=O)c1[nH]c2ccc(Cl)cc2c1Cl |
| InChI | InChI=1S/C14H14Cl2N2O3/c1-2-18(6-5-11(19)20)14(21)13-12(16)9-7-8(15)3-4-10(9)17-13/h3-4,7,17H,2,5-6H2,1H3,(H,19,20) |
| InChIKey | WVDWNISSYUKKMG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |