C19H19Cl2N3O — CID 55644479
3,5-dichloro-N-[2-(dimethylamino)-2-phenylethyl]-1H-indole-2-carboxamide (PubChem CID 55644479) has the molecular formula C19H19Cl2N3O and a molecular weight of 376.29 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-(dimethylamino)-2-phenylethyl]-1H-indole-2-carboxamide.
| Compound Name | 3,5-dichloro-N-[2-(dimethylamino)-2-phenylethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 55644479 |
| Molecular Formula | C19H19Cl2N3O |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 3,5-dichloro-N-[2-(dimethylamino)-2-phenylethyl]-1H-indole-2-carboxamide |
| SMILES | CN(C)C(CNC(=O)c1[nH]c2ccc(Cl)cc2c1Cl)c1ccccc1 |
| InChI | InChI=1S/C19H19Cl2N3O/c1-24(2)16(12-6-4-3-5-7-12)11-22-19(25)18-17(21)14-10-13(20)8-9-15(14)23-18/h3-10,16,23H,11H2,1-2H3,(H,22,25) |
| InChIKey | FRIRSLFYFBSOPN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |