C15H16Cl2N2O3S — CID 95661365
3,5-dichloro-N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethyl-1H-indole-2-carboxamide (PubChem CID 95661365) has the molecular formula C15H16Cl2N2O3S and a molecular weight of 375.28 g/mol. Its IUPAC name is 3,5-dichloro-N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethyl-1H-indole-2-carboxamide.
| Compound Name | 3,5-dichloro-N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 95661365 |
| Molecular Formula | C15H16Cl2N2O3S |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 3,5-dichloro-N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethyl-1H-indole-2-carboxamide |
| SMILES | CCN(C(=O)c1[nH]c2ccc(Cl)cc2c1Cl)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H16Cl2N2O3S/c1-2-19(10-5-6-23(21,22)8-10)15(20)14-13(17)11-7-9(16)3-4-12(11)18-14/h3-4,7,10,18H,2,5-6,8H2,1H3/t10-/m1/s1 |
| InChIKey | UZESPYOKNHTTBQ-SNVBAGLBSA-N |
| XLogP | 3.12 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |