C15H17Cl2NO3S — CID 42929616
(E)-3-(2,5-dichlorophenyl)-N-(1,1-dioxothiolan-3-yl)-N-ethylprop-2-enamide (PubChem CID 42929616) has the molecular formula C15H17Cl2NO3S and a molecular weight of 362.28 g/mol. Its IUPAC name is (E)-3-(2,5-dichlorophenyl)-N-(1,1-dioxothiolan-3-yl)-N-ethylprop-2-enamide.
| Compound Name | (E)-3-(2,5-dichlorophenyl)-N-(1,1-dioxothiolan-3-yl)-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 42929616 |
| Molecular Formula | C15H17Cl2NO3S |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | (E)-3-(2,5-dichlorophenyl)-N-(1,1-dioxothiolan-3-yl)-N-ethylprop-2-enamide |
| SMILES | CCN(C(=O)/C=C/c1cc(Cl)ccc1Cl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H17Cl2NO3S/c1-2-18(13-7-8-22(20,21)10-13)15(19)6-3-11-9-12(16)4-5-14(11)17/h3-6,9,13H,2,7-8,10H2,1H3/b6-3+ |
| InChIKey | AQZLGNQIYPLIRL-ZZXKWVIFSA-N |
| XLogP | 3.04 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|