C23H25Cl2NO3S — CID 3599462
3-(2,4-dichlorophenyl)-N-(1,1-dioxothiolan-3-yl)-N-[(4-propan-2-ylphenyl)methyl]prop-2-enamide (PubChem CID 3599462) has the molecular formula C23H25Cl2NO3S and a molecular weight of 466.43 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-(1,1-dioxothiolan-3-yl)-N-[(4-propan-2-ylphenyl)methyl]prop-2-enamide.
| Compound Name | 3-(2,4-dichlorophenyl)-N-(1,1-dioxothiolan-3-yl)-N-[(4-propan-2-ylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 3599462 |
| Molecular Formula | C23H25Cl2NO3S |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-(1,1-dioxothiolan-3-yl)-N-[(4-propan-2-ylphenyl)methyl]prop-2-enamide |
| SMILES | CC(C)c1ccc(CN(C(=O)C=Cc2ccc(Cl)cc2Cl)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C23H25Cl2NO3S/c1-16(2)18-5-3-17(4-6-18)14-26(21-11-12-30(28,29)15-21)23(27)10-8-19-7-9-20(24)13-22(19)25/h3-10,13,16,21H,11-12,14-15H2,1-2H3 |
| InChIKey | BBOAOUIQFRWEGW-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|