C21H21Cl2NO3S — CID 18879818
(E)-N-[(2,4-dichlorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-3-(4-methylphenyl)prop-2-enamide (PubChem CID 18879818) has the molecular formula C21H21Cl2NO3S and a molecular weight of 438.38 g/mol. Its IUPAC name is (E)-N-[(2,4-dichlorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(2,4-dichlorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 18879818 |
| Molecular Formula | C21H21Cl2NO3S |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | (E)-N-[(2,4-dichlorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-3-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)N(Cc2ccc(Cl)cc2Cl)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C21H21Cl2NO3S/c1-15-2-4-16(5-3-15)6-9-21(25)24(19-10-11-28(26,27)14-19)13-17-7-8-18(22)12-20(17)23/h2-9,12,19H,10-11,13-14H2,1H3/b9-6+ |
| InChIKey | XQDYLIRXBDSCOL-RMKNXTFCSA-N |
| XLogP | 4.53 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|