C29H24Cl2FN3O3S — CID 18879909
(E)-N-[(2,4-dichlorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-3-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]prop-2-enamide (PubChem CID 18879909) has the molecular formula C29H24Cl2FN3O3S and a molecular weight of 584.50 g/mol. Its IUPAC name is (E)-N-[(2,4-dichlorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-3-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]prop-2-enamide.
| Compound Name | (E)-N-[(2,4-dichlorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-3-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 18879909 |
| Molecular Formula | C29H24Cl2FN3O3S |
| Molecular Weight | 584.50 g/mol |
| Exact Mass | 583.09 |
| IUPAC Name | (E)-N-[(2,4-dichlorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-3-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cn(-c2ccccc2)nc1-c1ccc(F)cc1)N(Cc1ccc(Cl)cc1Cl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C29H24Cl2FN3O3S/c30-23-10-6-21(27(31)16-23)17-34(26-14-15-39(37,38)19-26)28(36)13-9-22-18-35(25-4-2-1-3-5-25)33-29(22)20-7-11-24(32)12-8-20/h1-13,16,18,26H,14-15,17,19H2/b13-9+ |
| InChIKey | QDYFMODYSUFXHX-UKTHLTGXSA-N |
| XLogP | 6.21 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.50 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|