C23H22ClN3O3S — CID 42893938
(E)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-N-(1,1-dioxothiolan-3-yl)-N-methylprop-2-enamide (PubChem CID 42893938) has the molecular formula C23H22ClN3O3S and a molecular weight of 455.97 g/mol. Its IUPAC name is (E)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-N-(1,1-dioxothiolan-3-yl)-N-methylprop-2-enamide.
| Compound Name | (E)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-N-(1,1-dioxothiolan-3-yl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 42893938 |
| Molecular Formula | C23H22ClN3O3S |
| Molecular Weight | 455.97 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | (E)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-N-(1,1-dioxothiolan-3-yl)-N-methylprop-2-enamide |
| SMILES | CN(C(=O)/C=C/c1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C23H22ClN3O3S/c1-26(21-13-14-31(29,30)16-21)22(28)12-9-18-15-27(20-5-3-2-4-6-20)25-23(18)17-7-10-19(24)11-8-17/h2-12,15,21H,13-14,16H2,1H3/b12-9+ |
| InChIKey | NGQNDUMWHWTPJO-FMIVXFBMSA-N |
| XLogP | 3.85 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.97 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|