C25H28N4O — CID 9167966
(E)-3-(1,3-diphenylpyrazol-4-yl)-N-methyl-N-(1-methylpiperidin-4-yl)prop-2-enamide (PubChem CID 9167966) has the molecular formula C25H28N4O and a molecular weight of 400.53 g/mol. Its IUPAC name is (E)-3-(1,3-diphenylpyrazol-4-yl)-N-methyl-N-(1-methylpiperidin-4-yl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-diphenylpyrazol-4-yl)-N-methyl-N-(1-methylpiperidin-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9167966 |
| Molecular Formula | C25H28N4O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | (E)-3-(1,3-diphenylpyrazol-4-yl)-N-methyl-N-(1-methylpiperidin-4-yl)prop-2-enamide |
| SMILES | CN1CCC(N(C)C(=O)/C=C/c2cn(-c3ccccc3)nc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C25H28N4O/c1-27-17-15-22(16-18-27)28(2)24(30)14-13-21-19-29(23-11-7-4-8-12-23)26-25(21)20-9-5-3-6-10-20/h3-14,19,22H,15-18H2,1-2H3/b14-13+ |
| InChIKey | OXKWTCHMBPRQJR-BUHFOSPRSA-N |
| XLogP | 4.11 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|