C25H22N4O — CID 78770992
3-(1,3-diphenylpyrazol-4-yl)-N-methyl-N-(pyridin-3-ylmethyl)prop-2-enamide (PubChem CID 78770992) has the molecular formula C25H22N4O and a molecular weight of 394.48 g/mol. Its IUPAC name is 3-(1,3-diphenylpyrazol-4-yl)-N-methyl-N-(pyridin-3-ylmethyl)prop-2-enamide.
| Compound Name | 3-(1,3-diphenylpyrazol-4-yl)-N-methyl-N-(pyridin-3-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 78770992 |
| Molecular Formula | C25H22N4O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 3-(1,3-diphenylpyrazol-4-yl)-N-methyl-N-(pyridin-3-ylmethyl)prop-2-enamide |
| SMILES | CN(Cc1cccnc1)C(=O)C=Cc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C25H22N4O/c1-28(18-20-9-8-16-26-17-20)24(30)15-14-22-19-29(23-12-6-3-7-13-23)27-25(22)21-10-4-2-5-11-21/h2-17,19H,18H2,1H3 |
| InChIKey | OAEBUWAVZCPIIZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|