C27H26N4O2 — CID 46555018
(E)-N-benzyl-N-(2-methoxyethyl)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enamide (PubChem CID 46555018) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is (E)-N-benzyl-N-(2-methoxyethyl)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-benzyl-N-(2-methoxyethyl)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 46555018 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | (E)-N-benzyl-N-(2-methoxyethyl)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enamide |
| SMILES | COCCN(Cc1ccccc1)C(=O)/C=C/c1cn(-c2ccccc2)nc1-c1cccnc1 |
| InChI | InChI=1S/C27H26N4O2/c1-33-18-17-30(20-22-9-4-2-5-10-22)26(32)15-14-24-21-31(25-12-6-3-7-13-25)29-27(24)23-11-8-16-28-19-23/h2-16,19,21H,17-18,20H2,1H3/b15-14+ |
| InChIKey | OJKAJCUKCIULNT-CCEZHUSRSA-N |
| XLogP | 4.62 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|