C23H23ClN4O2 — CID 9227007
(E)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-N-[2-(dimethylamino)-2-oxoethyl]-N-methylprop-2-enamide (PubChem CID 9227007) has the molecular formula C23H23ClN4O2 and a molecular weight of 422.92 g/mol. Its IUPAC name is (E)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-N-[2-(dimethylamino)-2-oxoethyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-N-[2-(dimethylamino)-2-oxoethyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 9227007 |
| Molecular Formula | C23H23ClN4O2 |
| Molecular Weight | 422.92 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | (E)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-N-[2-(dimethylamino)-2-oxoethyl]-N-methylprop-2-enamide |
| SMILES | CN(C)C(=O)CN(C)C(=O)/C=C/c1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H23ClN4O2/c1-26(2)22(30)16-27(3)21(29)14-11-18-15-28(20-7-5-4-6-8-20)25-23(18)17-9-12-19(24)13-10-17/h4-15H,16H2,1-3H3/b14-11+ |
| InChIKey | SOCRAXBRHUBMLO-SDNWHVSQSA-N |
| XLogP | 3.75 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.92 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|