C30H32N6O — CID 60609193
(E)-N-methyl-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-N-[1-(2-pyridin-2-ylethyl)piperidin-4-yl]prop-2-enamide (PubChem CID 60609193) has the molecular formula C30H32N6O and a molecular weight of 492.63 g/mol. Its IUPAC name is (E)-N-methyl-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-N-[1-(2-pyridin-2-ylethyl)piperidin-4-yl]prop-2-enamide.
| Compound Name | (E)-N-methyl-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-N-[1-(2-pyridin-2-ylethyl)piperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 60609193 |
| Molecular Formula | C30H32N6O |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | (E)-N-methyl-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-N-[1-(2-pyridin-2-ylethyl)piperidin-4-yl]prop-2-enamide |
| SMILES | CN(C(=O)/C=C/c1cn(-c2ccccc2)nc1-c1cccnc1)C1CCN(CCc2ccccn2)CC1 |
| InChI | InChI=1S/C30H32N6O/c1-34(27-15-20-35(21-16-27)19-14-26-9-5-6-18-32-26)29(37)13-12-25-23-36(28-10-3-2-4-11-28)33-30(25)24-8-7-17-31-22-24/h2-13,17-18,22-23,27H,14-16,19-21H2,1H3/b13-12+ |
| InChIKey | LXCNHNDTBCCUAN-OUKQBFOZSA-N |
| XLogP | 4.51 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|