C23H26F3N3O — CID 76878807
N-methyl-N-[1-(2-pyridin-2-ylethyl)piperidin-4-yl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 76878807) has the molecular formula C23H26F3N3O and a molecular weight of 417.48 g/mol. Its IUPAC name is N-methyl-N-[1-(2-pyridin-2-ylethyl)piperidin-4-yl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-methyl-N-[1-(2-pyridin-2-ylethyl)piperidin-4-yl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 76878807 |
| Molecular Formula | C23H26F3N3O |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | N-methyl-N-[1-(2-pyridin-2-ylethyl)piperidin-4-yl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CN(C(=O)C=Cc1ccc(C(F)(F)F)cc1)C1CCN(CCc2ccccn2)CC1 |
| InChI | InChI=1S/C23H26F3N3O/c1-28(22(30)10-7-18-5-8-19(9-6-18)23(24,25)26)21-12-16-29(17-13-21)15-11-20-4-2-3-14-27-20/h2-10,14,21H,11-13,15-17H2,1H3 |
| InChIKey | DCFSAQTWCWGDTN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|