C14H18ClF2NO2 — CID 111480490
2-chloro-4,5-difluoro-N-(4-hydroxy-2,2-dimethylpentyl)benzamide (PubChem CID 111480490) has the molecular formula C14H18ClF2NO2 and a molecular weight of 305.75 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-(4-hydroxy-2,2-dimethylpentyl)benzamide.
| Compound Name | 2-chloro-4,5-difluoro-N-(4-hydroxy-2,2-dimethylpentyl)benzamide |
|---|---|
| PubChem CID | 111480490 |
| Molecular Formula | C14H18ClF2NO2 |
| Molecular Weight | 305.75 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-(4-hydroxy-2,2-dimethylpentyl)benzamide |
| SMILES | CC(O)CC(C)(C)CNC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C14H18ClF2NO2/c1-8(19)6-14(2,3)7-18-13(20)9-4-11(16)12(17)5-10(9)15/h4-5,8,19H,6-7H2,1-3H3,(H,18,20) |
| InChIKey | ITLDVHFPOZKGQO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.75 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|