C17H16Cl2N2O3 — CID 87033246
3,5-dichloro-N-[3-(furan-2-ylmethoxy)propyl]-1H-indole-2-carboxamide (PubChem CID 87033246) has the molecular formula C17H16Cl2N2O3 and a molecular weight of 367.23 g/mol. Its IUPAC name is 3,5-dichloro-N-[3-(furan-2-ylmethoxy)propyl]-1H-indole-2-carboxamide.
| Compound Name | 3,5-dichloro-N-[3-(furan-2-ylmethoxy)propyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 87033246 |
| Molecular Formula | C17H16Cl2N2O3 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 3,5-dichloro-N-[3-(furan-2-ylmethoxy)propyl]-1H-indole-2-carboxamide |
| SMILES | O=C(NCCCOCc1ccco1)c1[nH]c2ccc(Cl)cc2c1Cl |
| InChI | InChI=1S/C17H16Cl2N2O3/c18-11-4-5-14-13(9-11)15(19)16(21-14)17(22)20-6-2-7-23-10-12-3-1-8-24-12/h1,3-5,8-9,21H,2,6-7,10H2,(H,20,22) |
| InChIKey | UIQYYHAOCKZWGV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|