C17H12Cl2F3N3O3S — CID 55913848
3,5-dichloro-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]-1H-indole-2-carboxamide (PubChem CID 55913848) has the molecular formula C17H12Cl2F3N3O3S and a molecular weight of 466.27 g/mol. Its IUPAC name is 3,5-dichloro-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]-1H-indole-2-carboxamide.
| Compound Name | 3,5-dichloro-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 55913848 |
| Molecular Formula | C17H12Cl2F3N3O3S |
| Molecular Weight | 466.27 g/mol |
| Exact Mass | 464.99 |
| IUPAC Name | 3,5-dichloro-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NCC(F)(F)F)cc1)c1[nH]c2ccc(Cl)cc2c1Cl |
| InChI | InChI=1S/C17H12Cl2F3N3O3S/c18-9-1-6-13-12(7-9)14(19)15(25-13)16(26)24-10-2-4-11(5-3-10)29(27,28)23-8-17(20,21)22/h1-7,23,25H,8H2,(H,24,26) |
| InChIKey | YIWNLIMPWCMZEG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.27 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |