C14H20F3N3O3S — CID 119692461
2-amino-2-methyl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]pentanamide (PubChem CID 119692461) has the molecular formula C14H20F3N3O3S and a molecular weight of 367.39 g/mol. Its IUPAC name is 2-amino-2-methyl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]pentanamide.
| Compound Name | 2-amino-2-methyl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 119692461 |
| Molecular Formula | C14H20F3N3O3S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 2-amino-2-methyl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]pentanamide |
| SMILES | CCCC(C)(N)C(=O)Nc1ccc(S(=O)(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H20F3N3O3S/c1-3-8-13(2,18)12(21)20-10-4-6-11(7-5-10)24(22,23)19-9-14(15,16)17/h4-7,19H,3,8-9,18H2,1-2H3,(H,20,21) |
| InChIKey | QMCQGUYOZNDQBX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |