C14H24ClN3O3S — CID 119792370
2-amino-N-[4-(methanesulfonamidomethyl)phenyl]-2-methylpentanamide;hydrochloride (PubChem CID 119792370) has the molecular formula C14H24ClN3O3S and a molecular weight of 349.88 g/mol. Its IUPAC name is 2-amino-N-[4-(methanesulfonamidomethyl)phenyl]-2-methylpentanamide;hydrochloride.
| Compound Name | 2-amino-N-[4-(methanesulfonamidomethyl)phenyl]-2-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119792370 |
| Molecular Formula | C14H24ClN3O3S |
| Molecular Weight | 349.88 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 2-amino-N-[4-(methanesulfonamidomethyl)phenyl]-2-methylpentanamide;hydrochloride |
| SMILES | CCCC(C)(N)C(=O)Nc1ccc(CNS(C)(=O)=O)cc1.Cl |
| InChI | InChI=1S/C14H23N3O3S.ClH/c1-4-9-14(2,15)13(18)17-12-7-5-11(6-8-12)10-16-21(3,19)20;/h5-8,16H,4,9-10,15H2,1-3H3,(H,17,18);1H |
| InChIKey | MLGQUZZUNZPZQY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.88 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |