C20H16ClF3N2O4S — CID 24515923
(E)-3-(6-chloro-2H-chromen-3-yl)-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 24515923) has the molecular formula C20H16ClF3N2O4S and a molecular weight of 472.87 g/mol. Its IUPAC name is (E)-3-(6-chloro-2H-chromen-3-yl)-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(6-chloro-2H-chromen-3-yl)-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 24515923 |
| Molecular Formula | C20H16ClF3N2O4S |
| Molecular Weight | 472.87 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | (E)-3-(6-chloro-2H-chromen-3-yl)-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/C1=Cc2cc(Cl)ccc2OC1)Nc1ccc(S(=O)(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H16ClF3N2O4S/c21-15-2-7-18-14(10-15)9-13(11-30-18)1-8-19(27)26-16-3-5-17(6-4-16)31(28,29)25-12-20(22,23)24/h1-10,25H,11-12H2,(H,26,27)/b8-1+ |
| InChIKey | XPCYOOHXNWBFBK-UNXLUWIOSA-N |
| XLogP | 4.15 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.87 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|