C15H13F3N2O3S2 — CID 9474835
(E)-3-thiophen-2-yl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 9474835) has the molecular formula C15H13F3N2O3S2 and a molecular weight of 390.41 g/mol. Its IUPAC name is (E)-3-thiophen-2-yl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-thiophen-2-yl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 9474835 |
| Molecular Formula | C15H13F3N2O3S2 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | (E)-3-thiophen-2-yl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccs1)Nc1ccc(S(=O)(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H13F3N2O3S2/c16-15(17,18)10-19-25(22,23)13-6-3-11(4-7-13)20-14(21)8-5-12-2-1-9-24-12/h1-9,19H,10H2,(H,20,21)/b8-5+ |
| InChIKey | ZZEZBNHVTIGOBQ-VMPITWQZSA-N |
| XLogP | 3.24 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|