C18H20ClNO3 — CID 111471268
3-(6-chloro-2H-chromen-3-yl)-N-[(2-hydroxycyclopentyl)methyl]prop-2-enamide (PubChem CID 111471268) has the molecular formula C18H20ClNO3 and a molecular weight of 333.81 g/mol. Its IUPAC name is 3-(6-chloro-2H-chromen-3-yl)-N-[(2-hydroxycyclopentyl)methyl]prop-2-enamide.
| Compound Name | 3-(6-chloro-2H-chromen-3-yl)-N-[(2-hydroxycyclopentyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 111471268 |
| Molecular Formula | C18H20ClNO3 |
| Molecular Weight | 333.81 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 3-(6-chloro-2H-chromen-3-yl)-N-[(2-hydroxycyclopentyl)methyl]prop-2-enamide |
| SMILES | O=C(C=CC1=Cc2cc(Cl)ccc2OC1)NCC1CCCC1O |
| InChI | InChI=1S/C18H20ClNO3/c19-15-5-6-17-14(9-15)8-12(11-23-17)4-7-18(22)20-10-13-2-1-3-16(13)21/h4-9,13,16,21H,1-3,10-11H2,(H,20,22) |
| InChIKey | DNRXQUXGPWXGMX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.81 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|