C19H15ClN2O3 — CID 9399460
2-[[(E)-3-(6-chloro-2H-chromen-3-yl)prop-2-enoyl]amino]benzamide (PubChem CID 9399460) has the molecular formula C19H15ClN2O3 and a molecular weight of 354.79 g/mol. Its IUPAC name is 2-[[(E)-3-(6-chloro-2H-chromen-3-yl)prop-2-enoyl]amino]benzamide.
| Compound Name | 2-[[(E)-3-(6-chloro-2H-chromen-3-yl)prop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 9399460 |
| Molecular Formula | C19H15ClN2O3 |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 2-[[(E)-3-(6-chloro-2H-chromen-3-yl)prop-2-enoyl]amino]benzamide |
| SMILES | NC(=O)c1ccccc1NC(=O)/C=C/C1=Cc2cc(Cl)ccc2OC1 |
| InChI | InChI=1S/C19H15ClN2O3/c20-14-6-7-17-13(10-14)9-12(11-25-17)5-8-18(23)22-16-4-2-1-3-15(16)19(21)24/h1-10H,11H2,(H2,21,24)(H,22,23)/b8-5+ |
| InChIKey | CNUZNNZTKQVJRN-VMPITWQZSA-N |
| XLogP | 3.41 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|